C37H34BF15N6O3 — CID 159497024
4-[3,5-bis(trifluoromethyl)phenyl]-2-piperidin-4-ylpyrimidine;[4-[4-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-2-yl]piperidin-1-yl]-methylborinic acid;2,2,2-trifluoroacetic acid (PubChem CID 159497024) has the molecular formula C37H34BF15N6O3 and a molecular weight of 906.50 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-2-piperidin-4-ylpyrimidine;[4-[4-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-2-yl]piperidin-1-yl]-methylborinic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-piperidin-4-ylpyrimidine;[4-[4-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-2-yl]piperidin-1-yl]-methylborinic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159497024 |
| Molecular Formula | C37H34BF15N6O3 |
| Molecular Weight | 906.50 g/mol |
| Exact Mass | 906.25 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-piperidin-4-ylpyrimidine;[4-[4-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-2-yl]piperidin-1-yl]-methylborinic acid;2,2,2-trifluoroacetic acid |
| SMILES | CB(O)N1CCC(c2nccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)CC1.FC(F)(F)c1cc(-c2ccnc(C3CCNCC3)n2)cc(C(F)(F)F)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H18BF6N3O.C17H15F6N3.C2HF3O2/c1-19(29)28-6-3-11(4-7-28)16-26-5-2-15(27-16)12-8-13(17(20,21)22)10-14(9-12)18(23,24)25;18-16(19,20)12-7-11(8-13(9-12)17(21,22)23)14-3-6-25-15(26-14)10-1-4-24-5-2-10;3-2(4,5)1(6)7/h2,5,8-11,29H,3-4,6-7H2,1H3;3,6-10,24H,1-2,4-5H2;(H,6,7) |
| InChIKey | VVZLWFOPBDHMHW-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.50 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|