C26H20Cl2N4O3Se — CID 159498738
3-chloro-5-ethenyl-2-(6-methyl-3-pyridinyl)pyridine;5-(3-chloro-5-ethenyl-2-pyridinyl)pyridine-2-carbaldehyde;selenium dioxide (PubChem CID 159498738) has the molecular formula C26H20Cl2N4O3Se and a molecular weight of 586.34 g/mol. Its IUPAC name is 3-chloro-5-ethenyl-2-(6-methyl-3-pyridinyl)pyridine;5-(3-chloro-5-ethenyl-2-pyridinyl)pyridine-2-carbaldehyde;selenium dioxide.
| Compound Name | 3-chloro-5-ethenyl-2-(6-methyl-3-pyridinyl)pyridine;5-(3-chloro-5-ethenyl-2-pyridinyl)pyridine-2-carbaldehyde;selenium dioxide |
|---|---|
| PubChem CID | 159498738 |
| Molecular Formula | C26H20Cl2N4O3Se |
| Molecular Weight | 586.34 g/mol |
| Exact Mass | 586.01 |
| IUPAC Name | 3-chloro-5-ethenyl-2-(6-methyl-3-pyridinyl)pyridine;5-(3-chloro-5-ethenyl-2-pyridinyl)pyridine-2-carbaldehyde;selenium dioxide |
| SMILES | C=Cc1cnc(-c2ccc(C)nc2)c(Cl)c1.C=Cc1cnc(-c2ccc(C=O)nc2)c(Cl)c1.O=[Se]=O |
| InChI | InChI=1S/C13H9ClN2O.C13H11ClN2.O2Se/c1-2-9-5-12(14)13(16-6-9)10-3-4-11(8-17)15-7-10;1-3-10-6-12(14)13(16-7-10)11-5-4-9(2)15-8-11;1-3-2/h2-8H,1H2;3-8H,1H2,2H3; |
| InChIKey | LZCOJMZCWQMHFE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 102.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.34 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|