About 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one
2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one (PubChem CID 15949921) has the molecular formula C20H15F2N3OS
and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one.
Molecular Properties
| Compound Name | 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one |
| PubChem CID | 15949921 |
| Molecular Formula | C20H15F2N3OS |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one |
| SMILES | CN1C(=O)C(c2ccsc2)(c2cccc(-c3cc(F)ccc3F)c2)N=C1N |
| InChI | InChI=1S/C20H15F2N3OS/c1-25-18(26)20(24-19(25)23,14-7-8-27-11-14)13-4-2-3-12(9-13)16-10-15(21)5-6-17(16)22/h2-11H,1H3,(H2,23,24) |
| InChIKey | BTBBHEGHDROAJX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one?
The IUPAC name of 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one (CID 15949921) is 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one.
What is the SMILES notation for 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one?
The canonical SMILES for 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one is CN1C(=O)C(c2ccsc2)(c2cccc(-c3cc(F)ccc3F)c2)N=C1N.
What is the InChIKey of 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one?
The InChIKey is BTBBHEGHDROAJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2N3OS/c1-25-18(26)20(24-19(25)23,14-7-8-27-11-14)13-4-2-3-12(9-13)16-10-15(21)5-6-17(16)22/h2-11H,1H3,(H2,23,24).
What are the key properties of 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one?
2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one has a molecular weight of 383.42 g/mol, XLogP of 3.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[3-(2,5-difluorophenyl)phenyl]-3-methyl-5-thiophen-3-ylimidazol-4-one is sourced from PubChem (CID 15949921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).