C28H33F2NO4 — CID 15949937
3-[(8R,9S,13S,14S,15R)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]propanamide (PubChem CID 15949937) has the molecular formula C28H33F2NO4 and a molecular weight of 485.57 g/mol. Its IUPAC name is 3-[(8R,9S,13S,14S,15R)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]propanamide.
| Compound Name | 3-[(8R,9S,13S,14S,15R)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 15949937 |
| Molecular Formula | C28H33F2NO4 |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 3-[(8R,9S,13S,14S,15R)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]propanamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1[C@H](CCC(=O)NCc1ccc(O)c(O)c1)CC2(F)F |
| InChI | InChI=1S/C28H33F2NO4/c1-27-11-10-21-20-7-5-19(32)13-17(20)3-6-22(21)26(27)18(14-28(27,29)30)4-9-25(35)31-15-16-2-8-23(33)24(34)12-16/h2,5,7-8,12-13,18,21-22,26,32-34H,3-4,6,9-11,14-15H2,1H3,(H,31,35)/t18-,21-,22-,26+,27+/m1/s1 |
| InChIKey | OFEAYKXVOTZXNE-PQPYGNNWSA-N |
| XLogP | 5.62 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|