C29H35F2NO4 — CID 15949941
4-[(8R,9S,13S,14S,15S)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]butanamide (PubChem CID 15949941) has the molecular formula C29H35F2NO4 and a molecular weight of 499.60 g/mol. Its IUPAC name is 4-[(8R,9S,13S,14S,15S)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]butanamide.
| Compound Name | 4-[(8R,9S,13S,14S,15S)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 15949941 |
| Molecular Formula | C29H35F2NO4 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 4-[(8R,9S,13S,14S,15S)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]butanamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1[C@@H](CCCC(=O)NCc1ccc(O)c(O)c1)CC2(F)F |
| InChI | InChI=1S/C29H35F2NO4/c1-28-12-11-22-21-9-7-20(33)14-18(21)6-8-23(22)27(28)19(15-29(28,30)31)3-2-4-26(36)32-16-17-5-10-24(34)25(35)13-17/h5,7,9-10,13-14,19,22-23,27,33-35H,2-4,6,8,11-12,15-16H2,1H3,(H,32,36)/t19-,22+,23+,27-,28-/m0/s1 |
| InChIKey | ZAODSTXMINEHEY-NPOQWARKSA-N |
| XLogP | 6.01 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|