C12H11BF7NO3 — CID 159499781
[2-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]boronic acid;prop-2-enamide (PubChem CID 159499781) has the molecular formula C12H11BF7NO3 and a molecular weight of 361.02 g/mol. Its IUPAC name is [2-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]boronic acid;prop-2-enamide.
| Compound Name | [2-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]boronic acid;prop-2-enamide |
|---|---|
| PubChem CID | 159499781 |
| Molecular Formula | C12H11BF7NO3 |
| Molecular Weight | 361.02 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | [2-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]boronic acid;prop-2-enamide |
| SMILES | C=CC(N)=O.OB(O)c1ccccc1C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6BF7O2.C3H5NO/c11-7(12,8(13,14)9(15,16)17)5-3-1-2-4-6(5)10(18)19;1-2-3(4)5/h1-4,18-19H;2H,1H2,(H2,4,5) |
| InChIKey | LZFUCNNVGBHXPG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.02 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|