About benzaldehyde;1H-benzimidazole
benzaldehyde;1H-benzimidazole (PubChem CID 159500530) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is benzaldehyde;1H-benzimidazole.
Molecular Properties
| Compound Name | benzaldehyde;1H-benzimidazole |
| PubChem CID | 159500530 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | benzaldehyde;1H-benzimidazole |
| SMILES | O=Cc1ccccc1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C7H6O/c1-2-4-7-6(3-1)8-5-9-7;8-6-7-4-2-1-3-5-7/h1-5H,(H,8,9);1-6H |
| InChIKey | LZIGUAARBUESJK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;1H-benzimidazole?
The IUPAC name of benzaldehyde;1H-benzimidazole (CID 159500530) is benzaldehyde;1H-benzimidazole.
What is the SMILES notation for benzaldehyde;1H-benzimidazole?
The canonical SMILES for benzaldehyde;1H-benzimidazole is O=Cc1ccccc1.c1ccc2[nH]cnc2c1.
What is the InChIKey of benzaldehyde;1H-benzimidazole?
The InChIKey is LZIGUAARBUESJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C7H6O/c1-2-4-7-6(3-1)8-5-9-7;8-6-7-4-2-1-3-5-7/h1-5H,(H,8,9);1-6H.
What are the key properties of benzaldehyde;1H-benzimidazole?
benzaldehyde;1H-benzimidazole has a molecular weight of 224.26 g/mol, XLogP of 3.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;1H-benzimidazole is sourced from PubChem (CID 159500530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).