C20H18F2N6O — CID 15950086
2-amino-5-(1-ethylpyrazol-4-yl)-5-[4-fluoro-3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one (PubChem CID 15950086) has the molecular formula C20H18F2N6O and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-amino-5-(1-ethylpyrazol-4-yl)-5-[4-fluoro-3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one.
| Compound Name | 2-amino-5-(1-ethylpyrazol-4-yl)-5-[4-fluoro-3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one |
|---|---|
| PubChem CID | 15950086 |
| Molecular Formula | C20H18F2N6O |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-amino-5-(1-ethylpyrazol-4-yl)-5-[4-fluoro-3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one |
| SMILES | CCn1cc(C2(c3ccc(F)c(-c4cccnc4F)c3)N=C(N)N(C)C2=O)cn1 |
| InChI | InChI=1S/C20H18F2N6O/c1-3-28-11-13(10-25-28)20(18(29)27(2)19(23)26-20)12-6-7-16(21)15(9-12)14-5-4-8-24-17(14)22/h4-11H,3H2,1-2H3,(H2,23,26) |
| InChIKey | XLKFXPAKZSTNHX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|