About 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate
2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate (PubChem CID 15950150) has the molecular formula C25H27F2N3O2
and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate |
| PubChem CID | 15950150 |
| Molecular Formula | C25H27F2N3O2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN(c2nc(-c3ccccc3C(F)F)cc3ccccc23)CC1 |
| InChI | InChI=1S/C25H27F2N3O2/c1-17(2)16-32-25(31)30-13-11-29(12-14-30)24-19-8-4-3-7-18(19)15-22(28-24)20-9-5-6-10-21(20)23(26)27/h3-10,15,17,23H,11-14,16H2,1-2H3 |
| InChIKey | FPSLYXUXYKUJNB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate?
The IUPAC name of 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate (CID 15950150) is 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate.
What is the SMILES notation for 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate?
The canonical SMILES for 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate is CC(C)COC(=O)N1CCN(c2nc(-c3ccccc3C(F)F)cc3ccccc23)CC1.
What is the InChIKey of 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate?
The InChIKey is FPSLYXUXYKUJNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27F2N3O2/c1-17(2)16-32-25(31)30-13-11-29(12-14-30)24-19-8-4-3-7-18(19)15-22(28-24)20-9-5-6-10-21(20)23(26)27/h3-10,15,17,23H,11-14,16H2,1-2H3.
What are the key properties of 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate?
2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate has a molecular weight of 439.51 g/mol, XLogP of 5.75, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate is sourced from PubChem (CID 15950150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).