C25H27F2N3O2 — CID 15950150
2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate (PubChem CID 15950150) has the molecular formula C25H27F2N3O2 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 15950150 |
| Molecular Formula | C25H27F2N3O2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2-methylpropyl 4-[3-[2-(difluoromethyl)phenyl]isoquinolin-1-yl]piperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN(c2nc(-c3ccccc3C(F)F)cc3ccccc23)CC1 |
| InChI | InChI=1S/C25H27F2N3O2/c1-17(2)16-32-25(31)30-13-11-29(12-14-30)24-19-8-4-3-7-18(19)15-22(28-24)20-9-5-6-10-21(20)23(26)27/h3-10,15,17,23H,11-14,16H2,1-2H3 |
| InChIKey | FPSLYXUXYKUJNB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |