About (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese
(3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese (PubChem CID 159501556) has the molecular formula C7H9Cl3MnN2O3
and a molecular weight of 330.46 g/mol. Its IUPAC name is (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese.
Molecular Properties
| Compound Name | (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese |
| PubChem CID | 159501556 |
| Molecular Formula | C7H9Cl3MnN2O3 |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 328.91 |
| IUPAC Name | (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese |
| SMILES | ClC(Cl)Cl.Nc1cnccc1CO.O=[Mn]=O |
| InChI | InChI=1S/C6H8N2O.CHCl3.Mn.2O/c7-6-3-8-2-1-5(6)4-9;2-1(3)4;;;/h1-3,9H,4,7H2;1H;;; |
| InChIKey | YUPQPNXRXOOXES-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese?
The IUPAC name of (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese (CID 159501556) is (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese.
What is the SMILES notation for (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese?
The canonical SMILES for (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese is ClC(Cl)Cl.Nc1cnccc1CO.O=[Mn]=O.
What is the InChIKey of (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese?
The InChIKey is YUPQPNXRXOOXES-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O.CHCl3.Mn.2O/c7-6-3-8-2-1-5(6)4-9;2-1(3)4;;;/h1-3,9H,4,7H2;1H;;;.
What are the key properties of (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese?
(3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese has a molecular weight of 330.46 g/mol, XLogP of 1.90, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-4-pyridinyl)methanol;chloroform;dioxomanganese is sourced from PubChem (CID 159501556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).