C31H42O3 — CID 159502889
6-[(5,8-dimethyl-4-oxo-2,3-dihydro-1H-naphthalen-2-yl)methyl]-5-ethylnonane-2,4-dione;toluene (PubChem CID 159502889) has the molecular formula C31H42O3 and a molecular weight of 462.67 g/mol. Its IUPAC name is 6-[(5,8-dimethyl-4-oxo-2,3-dihydro-1H-naphthalen-2-yl)methyl]-5-ethylnonane-2,4-dione;toluene.
| Compound Name | 6-[(5,8-dimethyl-4-oxo-2,3-dihydro-1H-naphthalen-2-yl)methyl]-5-ethylnonane-2,4-dione;toluene |
|---|---|
| PubChem CID | 159502889 |
| Molecular Formula | C31H42O3 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | 6-[(5,8-dimethyl-4-oxo-2,3-dihydro-1H-naphthalen-2-yl)methyl]-5-ethylnonane-2,4-dione;toluene |
| SMILES | CCCC(CC1CC(=O)c2c(C)ccc(C)c2C1)C(CC)C(=O)CC(C)=O.Cc1ccccc1 |
| InChI | InChI=1S/C24H34O3.C7H8/c1-6-8-19(20(7-2)22(26)11-17(5)25)12-18-13-21-15(3)9-10-16(4)24(21)23(27)14-18;1-7-5-3-2-4-6-7/h9-10,18-20H,6-8,11-14H2,1-5H3;2-6H,1H3 |
| InChIKey | LZPPBRQWGORNBX-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|