(2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid

C11H19F2NO2 — CID 159503206

IUPAC(2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid
SMILESCC[C@@H](CCN1CCCC(F)(F)C1)C(=O)O
InChIInChI=1S/C11H19F2NO2/c1-2-9(10(15)16)4-7-14-6-3-5-11(12,13)8-14/h9H,2-8H2,1H3,(H,15,16)/t9-/m0/s1
InChIKeyLZQOZIQFTSUXBX-VIFPVBQESA-N
MW235.27 g/mol
LogP2.22
Rot. Bonds5

About (2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid

(2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid (PubChem CID 159503206) has the molecular formula C11H19F2NO2 and a molecular weight of 235.27 g/mol. Its IUPAC name is (2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid.

Molecular Properties

Compound Name(2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid
PubChem CID159503206
Molecular FormulaC11H19F2NO2
Molecular Weight235.27 g/mol
Exact Mass235.14
IUPAC Name(2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid
SMILESCC[C@@H](CCN1CCCC(F)(F)C1)C(=O)O
InChIInChI=1S/C11H19F2NO2/c1-2-9(10(15)16)4-7-14-6-3-5-11(12,13)8-14/h9H,2-8H2,1H3,(H,15,16)/t9-/m0/s1
InChIKeyLZQOZIQFTSUXBX-VIFPVBQESA-N
XLogP2.22
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.27
LogP ≤ 52.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid?
The IUPAC name of (2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid (CID 159503206) is (2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid.
What is the SMILES notation for (2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid?
The canonical SMILES for (2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid is CC[C@@H](CCN1CCCC(F)(F)C1)C(=O)O.
What is the InChIKey of (2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid?
The InChIKey is LZQOZIQFTSUXBX-VIFPVBQESA-N. The full InChI is InChI=1S/C11H19F2NO2/c1-2-9(10(15)16)4-7-14-6-3-5-11(12,13)8-14/h9H,2-8H2,1H3,(H,15,16)/t9-/m0/s1.
What are the key properties of (2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid?
(2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid has a molecular weight of 235.27 g/mol, XLogP of 2.22, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(3,3-difluoropiperidin-1-yl)-2-ethylbutanoic acid is sourced from PubChem (CID 159503206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).