C28H18Br2Cl2N4O5 — CID 159503684
(5-bromo-3-chloro-2-pyridinyl)methanol;2-[(5-bromo-3-chloro-2-pyridinyl)methyl]isoindole-1,3-dione;isoindole-1,3-dione (PubChem CID 159503684) has the molecular formula C28H18Br2Cl2N4O5 and a molecular weight of 721.19 g/mol. Its IUPAC name is (5-bromo-3-chloro-2-pyridinyl)methanol;2-[(5-bromo-3-chloro-2-pyridinyl)methyl]isoindole-1,3-dione;isoindole-1,3-dione.
| Compound Name | (5-bromo-3-chloro-2-pyridinyl)methanol;2-[(5-bromo-3-chloro-2-pyridinyl)methyl]isoindole-1,3-dione;isoindole-1,3-dione |
|---|---|
| PubChem CID | 159503684 |
| Molecular Formula | C28H18Br2Cl2N4O5 |
| Molecular Weight | 721.19 g/mol |
| Exact Mass | 717.90 |
| IUPAC Name | (5-bromo-3-chloro-2-pyridinyl)methanol;2-[(5-bromo-3-chloro-2-pyridinyl)methyl]isoindole-1,3-dione;isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2ccccc21.O=C1c2ccccc2C(=O)N1Cc1ncc(Br)cc1Cl.OCc1ncc(Br)cc1Cl |
| InChI | InChI=1S/C14H8BrClN2O2.C8H5NO2.C6H5BrClNO/c15-8-5-11(16)12(17-6-8)7-18-13(19)9-3-1-2-4-10(9)14(18)20;10-7-5-3-1-2-4-6(5)8(11)9-7;7-4-1-5(8)6(3-10)9-2-4/h1-6H,7H2;1-4H,(H,9,10,11);1-2,10H,3H2 |
| InChIKey | LZSCDPPBDISRDZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.19 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|