C14H11FN2OS — CID 15950376
View drug profile → Flutemetamol (18F)2-[3-(18F)fluoro-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol (PubChem CID 15950376) has the molecular formula C14H11FN2OS and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-[3-(18F)fluoro-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol.
| Compound Name | 2-[3-(18F)fluoro-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 15950376 |
| Molecular Formula | C14H11FN2OS |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-[3-(18F)fluoro-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol |
| SMILES | CNc1ccc(-c2nc3ccc(O)cc3s2)cc1[18F] |
| InChI | InChI=1S/C14H11FN2OS/c1-16-11-4-2-8(6-10(11)15)14-17-12-5-3-9(18)7-13(12)19-14/h2-7,16,18H,1H3/i15-1 |
| InChIKey | VVECGOCJFKTUAX-HUYCHCPVSA-N |
| XLogP | 3.85 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |