C19H24N4S — CID 15950434
N'-[1-[4-(dimethylamino)butyl]indol-6-yl]thiophene-2-carboximidamide (PubChem CID 15950434) has the molecular formula C19H24N4S and a molecular weight of 340.50 g/mol. Its IUPAC name is N'-[1-[4-(dimethylamino)butyl]indol-6-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[1-[4-(dimethylamino)butyl]indol-6-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 15950434 |
| Molecular Formula | C19H24N4S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N'-[1-[4-(dimethylamino)butyl]indol-6-yl]thiophene-2-carboximidamide |
| SMILES | CN(C)CCCCn1ccc2ccc(/N=C(\N)c3cccs3)cc21 |
| InChI | InChI=1S/C19H24N4S/c1-22(2)10-3-4-11-23-12-9-15-7-8-16(14-17(15)23)21-19(20)18-6-5-13-24-18/h5-9,12-14H,3-4,10-11H2,1-2H3,(H2,20,21) |
| InChIKey | JAOUJDDSXCIDJS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|