C57H72N6O8 — CID 159504654
6-(4-benzhydryloxypiperidin-1-yl)hexan-1-ol;6-[6-(4-benzhydryloxypiperidin-1-yl)hexoxy]-[1,2,4]triazolo[1,5-b]pyridazine;but-2-enedioic acid (PubChem CID 159504654) has the molecular formula C57H72N6O8 and a molecular weight of 969.24 g/mol. Its IUPAC name is 6-(4-benzhydryloxypiperidin-1-yl)hexan-1-ol;6-[6-(4-benzhydryloxypiperidin-1-yl)hexoxy]-[1,2,4]triazolo[1,5-b]pyridazine;but-2-enedioic acid.
| Compound Name | 6-(4-benzhydryloxypiperidin-1-yl)hexan-1-ol;6-[6-(4-benzhydryloxypiperidin-1-yl)hexoxy]-[1,2,4]triazolo[1,5-b]pyridazine;but-2-enedioic acid |
|---|---|
| PubChem CID | 159504654 |
| Molecular Formula | C57H72N6O8 |
| Molecular Weight | 969.24 g/mol |
| Exact Mass | 968.54 |
| IUPAC Name | 6-(4-benzhydryloxypiperidin-1-yl)hexan-1-ol;6-[6-(4-benzhydryloxypiperidin-1-yl)hexoxy]-[1,2,4]triazolo[1,5-b]pyridazine;but-2-enedioic acid |
| SMILES | O=C(O)C=CC(=O)O.OCCCCCCN1CCC(OC(c2ccccc2)c2ccccc2)CC1.c1ccc(C(OC2CCN(CCCCCCOc3ccc4ncnn4n3)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H35N5O2.C24H33NO2.C4H4O4/c1(2-10-22-35-28-16-15-27-30-23-31-34(27)32-28)9-19-33-20-17-26(18-21-33)36-29(24-11-5-3-6-12-24)25-13-7-4-8-14-25;26-20-10-2-1-9-17-25-18-15-23(16-19-25)27-24(21-11-5-3-6-12-21)22-13-7-4-8-14-22;5-3(6)1-2-4(7)8/h3-8,11-16,23,26,29H,1-2,9-10,17-22H2;3-8,11-14,23-24,26H,1-2,9-10,15-20H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | LZVFDNJTSAATRH-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.24 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|