About azulene;sulfamide
azulene;sulfamide (PubChem CID 159505457) has the molecular formula C10H12N2O2S
and a molecular weight of 224.29 g/mol. Its IUPAC name is azulene;sulfamide.
Molecular Properties
| Compound Name | azulene;sulfamide |
| PubChem CID | 159505457 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | azulene;sulfamide |
| SMILES | NS(N)(=O)=O.c1ccc2cccc-2cc1 |
| InChI | InChI=1S/C10H8.H4N2O2S/c1-2-5-9-7-4-8-10(9)6-3-1;1-5(2,3)4/h1-8H;(H4,1,2,3,4) |
| InChIKey | LZXSOLIRPVFCQM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azulene;sulfamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azulene;sulfamide?
The IUPAC name of azulene;sulfamide (CID 159505457) is azulene;sulfamide.
What is the SMILES notation for azulene;sulfamide?
The canonical SMILES for azulene;sulfamide is NS(N)(=O)=O.c1ccc2cccc-2cc1.
What is the InChIKey of azulene;sulfamide?
The InChIKey is LZXSOLIRPVFCQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.H4N2O2S/c1-2-5-9-7-4-8-10(9)6-3-1;1-5(2,3)4/h1-8H;(H4,1,2,3,4).
What are the key properties of azulene;sulfamide?
azulene;sulfamide has a molecular weight of 224.29 g/mol, XLogP of 0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azulene;sulfamide is sourced from PubChem (CID 159505457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).