C18H24N2 — CID 15950548
3-(1-adamantyl)-5,6,7,8-tetrahydrocinnoline (PubChem CID 15950548) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3-(1-adamantyl)-5,6,7,8-tetrahydrocinnoline.
| Compound Name | 3-(1-adamantyl)-5,6,7,8-tetrahydrocinnoline |
|---|---|
| PubChem CID | 15950548 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 3-(1-adamantyl)-5,6,7,8-tetrahydrocinnoline |
| SMILES | c1c(C23CC4CC(CC(C4)C2)C3)nnc2c1CCCC2 |
| InChI | InChI=1S/C18H24N2/c1-2-4-16-15(3-1)8-17(20-19-16)18-9-12-5-13(10-18)7-14(6-12)11-18/h8,12-14H,1-7,9-11H2 |
| InChIKey | UDSCVHKQYRMXTN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |