C25H38Br3N5 — CID 159506452
1-(5-bromo-2-pyridinyl)-N,N-dimethylpiperidin-4-amine;2,5-dibromopyridine;N,N-dimethylcyclohexanamine (PubChem CID 159506452) has the molecular formula C25H38Br3N5 and a molecular weight of 648.33 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-N,N-dimethylpiperidin-4-amine;2,5-dibromopyridine;N,N-dimethylcyclohexanamine.
| Compound Name | 1-(5-bromo-2-pyridinyl)-N,N-dimethylpiperidin-4-amine;2,5-dibromopyridine;N,N-dimethylcyclohexanamine |
|---|---|
| PubChem CID | 159506452 |
| Molecular Formula | C25H38Br3N5 |
| Molecular Weight | 648.33 g/mol |
| Exact Mass | 645.07 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-N,N-dimethylpiperidin-4-amine;2,5-dibromopyridine;N,N-dimethylcyclohexanamine |
| SMILES | Brc1ccc(Br)nc1.CN(C)C1CCCCC1.CN(C)C1CCN(c2ccc(Br)cn2)CC1 |
| InChI | InChI=1S/C12H18BrN3.C8H17N.C5H3Br2N/c1-15(2)11-5-7-16(8-6-11)12-4-3-10(13)9-14-12;1-9(2)8-6-4-3-5-7-8;6-4-1-2-5(7)8-3-4/h3-4,9,11H,5-8H2,1-2H3;8H,3-7H2,1-2H3;1-3H |
| InChIKey | MAAZBWNZRMOCOE-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.33 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|