C20H17N5O — CID 15950666
2-amino-1-methyl-4-(3-(pyridin-3-yl)phenyl)-4-(pyridin-4-yl)-1H-imidazol-5(4H)-one (PubChem CID 15950666) has the molecular formula C20H17N5O and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-amino-3-methyl-5-pyridin-4-yl-5-(3-pyridin-3-ylphenyl)imidazol-4-one.
| Compound Name | 2-amino-1-methyl-4-(3-(pyridin-3-yl)phenyl)-4-(pyridin-4-yl)-1H-imidazol-5(4H)-one |
|---|---|
| PubChem CID | 15950666 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-amino-3-methyl-5-pyridin-4-yl-5-(3-pyridin-3-ylphenyl)imidazol-4-one |
| SMILES | CN1C(=O)C(N=C1N)(C2=CC=NC=C2)C3=CC=CC(=C3)C4=CN=CC=C4 |
| InChI | InChI=1S/C20H17N5O/c1-25-18(26)20(24-19(25)21,16-7-10-22-11-8-16)17-6-2-4-14(12-17)15-5-3-9-23-13-15/h2-13H,1H3,(H2,21,24) |
| InChIKey | AIKOTXHNUIYVMD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | 558 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |