About 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate
1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 159507364) has the molecular formula C24H44N2O7
and a molecular weight of 472.62 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate |
| PubChem CID | 159507364 |
| Molecular Formula | C24H44N2O7 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](CO)C1.CCOC(=O)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H23NO4.C11H21NO3/c1-5-17-11(15)10-7-6-8-14(9-10)12(16)18-13(2,3)4;1-11(2,3)15-10(14)12-6-4-5-9(7-12)8-13/h10H,5-9H2,1-4H3;9,13H,4-8H2,1-3H3/t10-;9-/m11/s1 |
| InChIKey | MADZWLOXPKPGQF-AYEYZUDDSA-N |
| XLogP | 3.82 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate?
The IUPAC name of 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate (CID 159507364) is 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate.
What is the SMILES notation for 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate?
The canonical SMILES for 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC[C@@H](CO)C1.CCOC(=O)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1.
What is the InChIKey of 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate?
The InChIKey is MADZWLOXPKPGQF-AYEYZUDDSA-N. The full InChI is InChI=1S/C13H23NO4.C11H21NO3/c1-5-17-11(15)10-7-6-8-14(9-10)12(16)18-13(2,3)4;1-11(2,3)15-10(14)12-6-4-5-9(7-12)8-13/h10H,5-9H2,1-4H3;9,13H,4-8H2,1-3H3/t10-;9-/m11/s1.
What are the key properties of 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate?
1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate has a molecular weight of 472.62 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate;tert-butyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate is sourced from PubChem (CID 159507364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).