C38H30N2 — CID 159508303
2-methyl-9-phenylcarbazole;3-methyl-9-phenylcarbazole (PubChem CID 159508303) has the molecular formula C38H30N2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 2-methyl-9-phenylcarbazole;3-methyl-9-phenylcarbazole.
| Compound Name | 2-methyl-9-phenylcarbazole;3-methyl-9-phenylcarbazole |
|---|---|
| PubChem CID | 159508303 |
| Molecular Formula | C38H30N2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 2-methyl-9-phenylcarbazole;3-methyl-9-phenylcarbazole |
| SMILES | Cc1ccc2c(c1)c1ccccc1n2-c1ccccc1.Cc1ccc2c3ccccc3n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/2C19H15N/c1-14-11-12-19-17(13-14)16-9-5-6-10-18(16)20(19)15-7-3-2-4-8-15;1-14-11-12-17-16-9-5-6-10-18(16)20(19(17)13-14)15-7-3-2-4-8-15/h2*2-13H,1H3 |
| InChIKey | MAGVWYKAXOLYQQ-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |