C20H19Cl2Zr — CID 159508374
1-(2-methyl-4,5,6,7-tetrahydro-1H-inden-1-id-4-yl)naphthalene;zirconium(3+);dichloride (PubChem CID 159508374) has the molecular formula C20H19Cl2Zr and a molecular weight of 421.50 g/mol. Its IUPAC name is 1-(2-methyl-4,5,6,7-tetrahydro-1H-inden-1-id-4-yl)naphthalene;zirconium(3+);dichloride.
| Compound Name | 1-(2-methyl-4,5,6,7-tetrahydro-1H-inden-1-id-4-yl)naphthalene;zirconium(3+);dichloride |
|---|---|
| PubChem CID | 159508374 |
| Molecular Formula | C20H19Cl2Zr |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | 1-(2-methyl-4,5,6,7-tetrahydro-1H-inden-1-id-4-yl)naphthalene;zirconium(3+);dichloride |
| SMILES | Cc1cc2c([cH-]1)CCCC2c1cccc2ccccc12.[Cl-].[Cl-].[Zr+3] |
| InChI | InChI=1S/C20H19.2ClH.Zr/c1-14-12-16-8-5-11-19(20(16)13-14)18-10-4-7-15-6-2-3-9-17(15)18;;;/h2-4,6-7,9-10,12-13,19H,5,8,11H2,1H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | NZZBOVNRJHGOLZ-UHFFFAOYSA-L |
| XLogP | -0.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|