C25H31N3O4 — CID 159508683
carbamic acid;(2R)-2-(3-hydroxy-1-adamantyl)-1-[(1S,3R,5S)-3-isocyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-phenylethanone (PubChem CID 159508683) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is carbamic acid;(2R)-2-(3-hydroxy-1-adamantyl)-1-[(1S,3R,5S)-3-isocyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-phenylethanone.
| Compound Name | carbamic acid;(2R)-2-(3-hydroxy-1-adamantyl)-1-[(1S,3R,5S)-3-isocyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 159508683 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | carbamic acid;(2R)-2-(3-hydroxy-1-adamantyl)-1-[(1S,3R,5S)-3-isocyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-phenylethanone |
| SMILES | NC(=O)O.[C-]#[N+][C@@H]1C[C@@H]2C[C@@H]2N1C(=O)[C@@H](c1ccccc1)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C24H28N2O2.CH3NO2/c1-25-20-9-18-8-19(18)26(20)22(27)21(17-5-3-2-4-6-17)23-10-15-7-16(11-23)13-24(28,12-15)14-23;2-1(3)4/h2-6,15-16,18-21,28H,7-14H2;2H2,(H,3,4)/t15?,16?,18-,19-,20-,21+,23?,24?;/m0./s1 |
| InChIKey | MAICMULNTJMERV-KNAKELRQSA-N |
| XLogP | 3.59 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|