C30H29F3N6O4 — CID 15950887
3-(13-ethyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl)-5-methoxy-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 15950887) has the molecular formula C30H29F3N6O4 and a molecular weight of 594.59 g/mol. Its IUPAC name is 3-(13-ethyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl)-5-methoxy-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(13-ethyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl)-5-methoxy-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 15950887 |
| Molecular Formula | C30H29F3N6O4 |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | 3-(13-ethyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-yl)-5-methoxy-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCN1C(=O)N(c2cc(OC)cc(C(=O)Nc3ccc(N4CCOCC4)c(C(F)(F)F)c3)c2)Cc2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C30H29F3N6O4/c1-3-38-26-19(16-35-27-23(26)6-7-34-27)17-39(29(38)41)21-12-18(13-22(15-21)42-2)28(40)36-20-4-5-25(24(14-20)30(31,32)33)37-8-10-43-11-9-37/h4-7,12-16H,3,8-11,17H2,1-2H3,(H,34,35)(H,36,40) |
| InChIKey | LIQWYXTZEODIFB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|