C21H30FNO5S — CID 159509118
tert-butyl 4-[4-(3-fluoro-4-methylsulfonylphenyl)-3-oxobutyl]piperidine-1-carboxylate (PubChem CID 159509118) has the molecular formula C21H30FNO5S and a molecular weight of 427.54 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-fluoro-4-methylsulfonylphenyl)-3-oxobutyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3-fluoro-4-methylsulfonylphenyl)-3-oxobutyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 159509118 |
| Molecular Formula | C21H30FNO5S |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | tert-butyl 4-[4-(3-fluoro-4-methylsulfonylphenyl)-3-oxobutyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCC(=O)Cc2ccc(S(C)(=O)=O)c(F)c2)CC1 |
| InChI | InChI=1S/C21H30FNO5S/c1-21(2,3)28-20(25)23-11-9-15(10-12-23)5-7-17(24)13-16-6-8-19(18(22)14-16)29(4,26)27/h6,8,14-15H,5,7,9-13H2,1-4H3 |
| InChIKey | MAJKBQGDODVHIA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |