C27H22N2O2 — CID 159509822
3,3-bis(2-phenyl-3-pyridinyl)pentane-2,4-dione (PubChem CID 159509822) has the molecular formula C27H22N2O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 3,3-bis(2-phenyl-3-pyridinyl)pentane-2,4-dione.
| Compound Name | 3,3-bis(2-phenyl-3-pyridinyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 159509822 |
| Molecular Formula | C27H22N2O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 3,3-bis(2-phenyl-3-pyridinyl)pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)(c1cccnc1-c1ccccc1)c1cccnc1-c1ccccc1 |
| InChI | InChI=1S/C27H22N2O2/c1-19(30)27(20(2)31,23-15-9-17-28-25(23)21-11-5-3-6-12-21)24-16-10-18-29-26(24)22-13-7-4-8-14-22/h3-18H,1-2H3 |
| InChIKey | XWYDQOVALRNYCJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|