C19H18ClN3O2S — CID 15951010
2-(4-((2-(5-Chlorothiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl)amino)phenyl)acetic acid (PubChem CID 15951010) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.90 g/mol. Its IUPAC name is 2-[4-[[2-(5-chlorothiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid.
| Compound Name | 2-(4-((2-(5-Chlorothiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl)amino)phenyl)acetic acid |
|---|---|
| PubChem CID | 15951010 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-[4-[[2-(5-chlorothiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid |
| SMILES | CCC1=C(N=C(N=C1NC2=CC=C(C=C2)CC(=O)O)C3=CC=C(S3)Cl)C |
| InChI | InChI=1S/C19H18ClN3O2S/c1-3-14-11(2)21-19(15-8-9-16(20)26-15)23-18(14)22-13-6-4-12(5-7-13)10-17(24)25/h4-9H,3,10H2,1-2H3,(H,24,25)(H,21,22,23) |
| InChIKey | FDVSPBLZPJMXFV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 476 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |