C21H32O4 — CID 159510614
(4S,5R,6R)-4-ethenyl-2,2,5-trimethyl-6-prop-2-ynyl-1,3-dioxane;(3S,4R,5R)-4-methyloct-1-en-7-yne-3,5-diol (PubChem CID 159510614) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (4S,5R,6R)-4-ethenyl-2,2,5-trimethyl-6-prop-2-ynyl-1,3-dioxane;(3S,4R,5R)-4-methyloct-1-en-7-yne-3,5-diol.
| Compound Name | (4S,5R,6R)-4-ethenyl-2,2,5-trimethyl-6-prop-2-ynyl-1,3-dioxane;(3S,4R,5R)-4-methyloct-1-en-7-yne-3,5-diol |
|---|---|
| PubChem CID | 159510614 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (4S,5R,6R)-4-ethenyl-2,2,5-trimethyl-6-prop-2-ynyl-1,3-dioxane;(3S,4R,5R)-4-methyloct-1-en-7-yne-3,5-diol |
| SMILES | C#CC[C@@H](O)[C@@H](C)[C@@H](O)C=C.C#CC[C@H]1OC(C)(C)O[C@@H](C=C)[C@@H]1C |
| InChI | InChI=1S/C12H18O2.C9H14O2/c1-6-8-11-9(3)10(7-2)13-12(4,5)14-11;1-4-6-9(11)7(3)8(10)5-2/h1,7,9-11H,2,8H2,3-5H3;1,5,7-11H,2,6H2,3H3/t9-,10-,11+;7-,8-,9+/m00/s1 |
| InChIKey | MAOAGNIPQWCMDO-VEFZRXFESA-N |
| XLogP | 2.91 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|