C28H33FN5O6P — CID 159510754
2-[ethyl-[3-[4-[[3-[3-(3-fluorophenyl)-2-oxopropyl]-2H-pyrrol-5-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate (PubChem CID 159510754) has the molecular formula C28H33FN5O6P and a molecular weight of 585.57 g/mol. Its IUPAC name is 2-[ethyl-[3-[4-[[3-[3-(3-fluorophenyl)-2-oxopropyl]-2H-pyrrol-5-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[ethyl-[3-[4-[[3-[3-(3-fluorophenyl)-2-oxopropyl]-2H-pyrrol-5-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 159510754 |
| Molecular Formula | C28H33FN5O6P |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 2-[ethyl-[3-[4-[[3-[3-(3-fluorophenyl)-2-oxopropyl]-2H-pyrrol-5-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate |
| SMILES | CCN(CCCOc1ccc2c(NC3=NCC(CC(=O)Cc4cccc(F)c4)=C3)ncnc2c1)CCOP(=O)(O)O |
| InChI | InChI=1S/C28H33FN5O6P/c1-2-34(10-12-40-41(36,37)38)9-4-11-39-24-7-8-25-26(17-24)31-19-32-28(25)33-27-16-21(18-30-27)15-23(35)14-20-5-3-6-22(29)13-20/h3,5-8,13,16-17,19H,2,4,9-12,14-15,18H2,1H3,(H2,36,37,38)(H,30,31,32,33) |
| InChIKey | MAONQOROXMNARK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 146.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|