C20H24N4S — CID 15951130
N'-[1-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]indol-6-yl]thiophene-2-carboximidamide (PubChem CID 15951130) has the molecular formula C20H24N4S and a molecular weight of 352.51 g/mol. Its IUPAC name is N'-[1-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]indol-6-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[1-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]indol-6-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 15951130 |
| Molecular Formula | C20H24N4S |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N'-[1-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]indol-6-yl]thiophene-2-carboximidamide |
| SMILES | CN1CCC[C@@H]1CCn1ccc2ccc(/N=C(\N)c3cccs3)cc21 |
| InChI | InChI=1S/C20H24N4S/c1-23-10-2-4-17(23)9-12-24-11-8-15-6-7-16(14-18(15)24)22-20(21)19-5-3-13-25-19/h3,5-8,11,13-14,17H,2,4,9-10,12H2,1H3,(H2,21,22)/t17-/m1/s1 |
| InChIKey | ZPYXFXHKINDFBM-QGZVFWFLSA-N |
| XLogP | 4.22 |
| TPSA | 46.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|