About S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate
S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate (PubChem CID 15951142) has the molecular formula C22H27FN2OS2
and a molecular weight of 418.60 g/mol. Its IUPAC name is S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate.
Molecular Properties
| Compound Name | S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate |
| PubChem CID | 15951142 |
| Molecular Formula | C22H27FN2OS2 |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate |
| SMILES | CCCC1(CCC)CS/C(=N\c2ccc(F)c3ccccc23)N(C(=O)SC)C1 |
| InChI | InChI=1S/C22H27FN2OS2/c1-4-12-22(13-5-2)14-25(21(26)27-3)20(28-15-22)24-19-11-10-18(23)16-8-6-7-9-17(16)19/h6-11H,4-5,12-15H2,1-3H3/b24-20- |
| InChIKey | LISHRXZHOZXWEG-GFMRDNFCSA-N |
| XLogP | 7.08 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate?
The IUPAC name of S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate (CID 15951142) is S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate.
What is the SMILES notation for S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate?
The canonical SMILES for S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate is CCCC1(CCC)CS/C(=N\c2ccc(F)c3ccccc23)N(C(=O)SC)C1.
What is the InChIKey of S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate?
The InChIKey is LISHRXZHOZXWEG-GFMRDNFCSA-N. The full InChI is InChI=1S/C22H27FN2OS2/c1-4-12-22(13-5-2)14-25(21(26)27-3)20(28-15-22)24-19-11-10-18(23)16-8-6-7-9-17(16)19/h6-11H,4-5,12-15H2,1-3H3/b24-20-.
What are the key properties of S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate?
S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate has a molecular weight of 418.60 g/mol, XLogP of 7.08, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 2-(4-fluoronaphthalen-1-yl)imino-5,5-dipropyl-1,3-thiazinane-3-carbothioate is sourced from PubChem (CID 15951142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).