C23H28N2 — CID 159511691
(3S)-9-[(2,5-dimethylphenyl)methyl]-N,N-dimethyl-1,2,3,4-tetrahydrocarbazol-3-amine (PubChem CID 159511691) has the molecular formula C23H28N2 and a molecular weight of 332.49 g/mol. Its IUPAC name is (3S)-9-[(2,5-dimethylphenyl)methyl]-N,N-dimethyl-1,2,3,4-tetrahydrocarbazol-3-amine.
| Compound Name | (3S)-9-[(2,5-dimethylphenyl)methyl]-N,N-dimethyl-1,2,3,4-tetrahydrocarbazol-3-amine |
|---|---|
| PubChem CID | 159511691 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | (3S)-9-[(2,5-dimethylphenyl)methyl]-N,N-dimethyl-1,2,3,4-tetrahydrocarbazol-3-amine |
| SMILES | Cc1ccc(C)c(Cn2c3c(c4ccccc42)C[C@@H](N(C)C)CC3)c1 |
| InChI | InChI=1S/C23H28N2/c1-16-9-10-17(2)18(13-16)15-25-22-8-6-5-7-20(22)21-14-19(24(3)4)11-12-23(21)25/h5-10,13,19H,11-12,14-15H2,1-4H3/t19-/m0/s1 |
| InChIKey | MARKOSMEWPTGFV-IBGZPJMESA-N |
| XLogP | 4.73 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|