C7H15F3N2-2 — CID 159511778
2,2-dimethylpropylazanide;2,2,2-trifluoroethylazanide (PubChem CID 159511778) has the molecular formula C7H15F3N2-2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 2,2-dimethylpropylazanide;2,2,2-trifluoroethylazanide.
| Compound Name | 2,2-dimethylpropylazanide;2,2,2-trifluoroethylazanide |
|---|---|
| PubChem CID | 159511778 |
| Molecular Formula | C7H15F3N2-2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 2,2-dimethylpropylazanide;2,2,2-trifluoroethylazanide |
| SMILES | CC(C)(C)C[NH-].[NH-]CC(F)(F)F |
| InChI | InChI=1S/C5H12N.C2H3F3N/c1-5(2,3)4-6;3-2(4,5)1-6/h6H,4H2,1-3H3;6H,1H2/q2*-1 |
| InChIKey | MARQXSJICKLXCT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |