About S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate
S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate (PubChem CID 15951212) has the molecular formula C22H26N2OS2
and a molecular weight of 398.60 g/mol. Its IUPAC name is S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate.
Molecular Properties
| Compound Name | S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate |
| PubChem CID | 15951212 |
| Molecular Formula | C22H26N2OS2 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate |
| SMILES | CSC(=O)N1CC2(CCCCCC2)CS/C1=N\c1cccc2ccccc12 |
| InChI | InChI=1S/C22H26N2OS2/c1-26-21(25)24-15-22(13-6-2-3-7-14-22)16-27-20(24)23-19-12-8-10-17-9-4-5-11-18(17)19/h4-5,8-12H,2-3,6-7,13-16H2,1H3/b23-20- |
| InChIKey | WMOFNXZASRKDIP-ATJXCDBQSA-N |
| XLogP | 6.70 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate?
The IUPAC name of S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate (CID 15951212) is S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate.
What is the SMILES notation for S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate?
The canonical SMILES for S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate is CSC(=O)N1CC2(CCCCCC2)CS/C1=N\c1cccc2ccccc12.
What is the InChIKey of S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate?
The InChIKey is WMOFNXZASRKDIP-ATJXCDBQSA-N. The full InChI is InChI=1S/C22H26N2OS2/c1-26-21(25)24-15-22(13-6-2-3-7-14-22)16-27-20(24)23-19-12-8-10-17-9-4-5-11-18(17)19/h4-5,8-12H,2-3,6-7,13-16H2,1H3/b23-20-.
What are the key properties of S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate?
S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate has a molecular weight of 398.60 g/mol, XLogP of 6.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.6]dodecane-4-carbothioate is sourced from PubChem (CID 15951212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).