C31H36N4O6 — CID 15951298
3,8-bis[(3,5-dimethoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 15951298) has the molecular formula C31H36N4O6 and a molecular weight of 560.65 g/mol. Its IUPAC name is 3,8-bis[(3,5-dimethoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3,8-bis[(3,5-dimethoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 15951298 |
| Molecular Formula | C31H36N4O6 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 3,8-bis[(3,5-dimethoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1cc(CN2CCC3(CC2)C(=O)N(Cc2cc(OC)cc(OC)c2)C(=O)N3Cc2ccncc2)cc(OC)c1 |
| InChI | InChI=1S/C31H36N4O6/c1-38-25-13-23(14-26(17-25)39-2)19-33-11-7-31(8-12-33)29(36)34(20-24-15-27(40-3)18-28(16-24)41-4)30(37)35(31)21-22-5-9-32-10-6-22/h5-6,9-10,13-18H,7-8,11-12,19-21H2,1-4H3 |
| InChIKey | KCDVRPADUYTNCE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|