C31H26Cl2N4O2 — CID 159513606
tert-butyl 2-(2-chloro-4-pyridinyl)indole-1-carboxylate;2-(2-chloro-4-pyridinyl)-1H-indole (PubChem CID 159513606) has the molecular formula C31H26Cl2N4O2 and a molecular weight of 557.48 g/mol. Its IUPAC name is tert-butyl 2-(2-chloro-4-pyridinyl)indole-1-carboxylate;2-(2-chloro-4-pyridinyl)-1H-indole.
| Compound Name | tert-butyl 2-(2-chloro-4-pyridinyl)indole-1-carboxylate;2-(2-chloro-4-pyridinyl)-1H-indole |
|---|---|
| PubChem CID | 159513606 |
| Molecular Formula | C31H26Cl2N4O2 |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | tert-butyl 2-(2-chloro-4-pyridinyl)indole-1-carboxylate;2-(2-chloro-4-pyridinyl)-1H-indole |
| SMILES | CC(C)(C)OC(=O)n1c(-c2ccnc(Cl)c2)cc2ccccc21.Clc1cc(-c2cc3ccccc3[nH]2)ccn1 |
| InChI | InChI=1S/C18H17ClN2O2.C13H9ClN2/c1-18(2,3)23-17(22)21-14-7-5-4-6-12(14)10-15(21)13-8-9-20-16(19)11-13;14-13-8-10(5-6-15-13)12-7-9-3-1-2-4-11(9)16-12/h4-11H,1-3H3;1-8,16H |
| InChIKey | MAXDYNPHWUMDIF-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|