C16H19F2N3O4 — CID 15951373
N-[[(5S)-3-[3,5-difluoro-4-(3-methoxyazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 15951373) has the molecular formula C16H19F2N3O4 and a molecular weight of 355.34 g/mol. Its IUPAC name is N-[[(5S)-3-[3,5-difluoro-4-(3-methoxyazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3,5-difluoro-4-(3-methoxyazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 15951373 |
| Molecular Formula | C16H19F2N3O4 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[[(5S)-3-[3,5-difluoro-4-(3-methoxyazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | COC1CN(c2c(F)cc(N3C[C@H](CNC(C)=O)OC3=O)cc2F)C1 |
| InChI | InChI=1S/C16H19F2N3O4/c1-9(22)19-5-11-8-21(16(23)25-11)10-3-13(17)15(14(18)4-10)20-6-12(7-20)24-2/h3-4,11-12H,5-8H2,1-2H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | YGCLXTRHFRBOMF-NSHDSACASA-N |
| XLogP | 1.26 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|