About CID 159515178
CID 159515178 (PubChem CID 159515178) has the molecular formula C21H24N4O4
and a molecular weight of 396.45 g/mol.
Molecular Properties
| Compound Name | CID 159515178 |
| PubChem CID | 159515178 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | — |
| SMILES | Cn1cc(C(=O)Cc2ccc3c(c2)C2(COC(N)=N2)C2(COC2)C(C)(C)O3)cn1 |
| InChI | InChI=1S/C21H24N4O4/c1-19(2)20(10-27-11-20)21(12-28-18(22)24-21)15-6-13(4-5-17(15)29-19)7-16(26)14-8-23-25(3)9-14/h4-6,8-9H,7,10-12H2,1-3H3,(H2,22,24) |
| InChIKey | MBCHAIHJGITMSP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 159515178 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159515178?
The IUPAC name of CID 159515178 (CID 159515178) is not available.
What is the SMILES notation for CID 159515178?
The canonical SMILES for CID 159515178 is Cn1cc(C(=O)Cc2ccc3c(c2)C2(COC(N)=N2)C2(COC2)C(C)(C)O3)cn1.
What is the InChIKey of CID 159515178?
The InChIKey is MBCHAIHJGITMSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O4/c1-19(2)20(10-27-11-20)21(12-28-18(22)24-21)15-6-13(4-5-17(15)29-19)7-16(26)14-8-23-25(3)9-14/h4-6,8-9H,7,10-12H2,1-3H3,(H2,22,24).
What are the key properties of CID 159515178?
CID 159515178 has a molecular weight of 396.45 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159515178 is sourced from PubChem (CID 159515178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).