About 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate
7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate (PubChem CID 159515274) has the molecular formula C16H23NO6
and a molecular weight of 325.36 g/mol. Its IUPAC name is 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate.
Molecular Properties
| Compound Name | 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate |
| PubChem CID | 159515274 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate |
| SMILES | CC[C@H](O)c1ccc(O)c2c1CC(=O)N2.COC(=O)C(C)(C)O |
| InChI | InChI=1S/C11H13NO3.C5H10O3/c1-2-8(13)6-3-4-9(14)11-7(6)5-10(15)12-11;1-5(2,7)4(6)8-3/h3-4,8,13-14H,2,5H2,1H3,(H,12,15);7H,1-3H3/t8-;/m0./s1 |
| InChIKey | MBCOPZWYQOKVPQ-QRPNPIFTSA-N |
| XLogP | 1.26 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate?
The IUPAC name of 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate (CID 159515274) is 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate.
What is the SMILES notation for 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate?
The canonical SMILES for 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate is CC[C@H](O)c1ccc(O)c2c1CC(=O)N2.COC(=O)C(C)(C)O.
What is the InChIKey of 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate?
The InChIKey is MBCOPZWYQOKVPQ-QRPNPIFTSA-N. The full InChI is InChI=1S/C11H13NO3.C5H10O3/c1-2-8(13)6-3-4-9(14)11-7(6)5-10(15)12-11;1-5(2,7)4(6)8-3/h3-4,8,13-14H,2,5H2,1H3,(H,12,15);7H,1-3H3/t8-;/m0./s1.
What are the key properties of 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate?
7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate has a molecular weight of 325.36 g/mol, XLogP of 1.26, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-4-[(1S)-1-hydroxypropyl]-1,3-dihydroindol-2-one;methyl 2-hydroxy-2-methylpropanoate is sourced from PubChem (CID 159515274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).