About 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane
9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane (PubChem CID 159515846) has the molecular formula C23H24F2N6
and a molecular weight of 422.48 g/mol. Its IUPAC name is 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane.
Molecular Properties
| Compound Name | 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane |
| PubChem CID | 159515846 |
| Molecular Formula | C23H24F2N6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane |
| SMILES | C.Fc1ccc(Nc2ncc3nc(Nc4ccccc4F)n(C4CCCC4)c3n2)cc1 |
| InChI | InChI=1S/C22H20F2N6.CH4/c23-14-9-11-15(12-10-14)26-21-25-13-19-20(29-21)30(16-5-1-2-6-16)22(28-19)27-18-8-4-3-7-17(18)24;/h3-4,7-13,16H,1-2,5-6H2,(H,27,28)(H,25,26,29);1H4 |
| InChIKey | MBEMPIKFXWHVIF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane?
The IUPAC name of 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane (CID 159515846) is 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane.
What is the SMILES notation for 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane?
The canonical SMILES for 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane is C.Fc1ccc(Nc2ncc3nc(Nc4ccccc4F)n(C4CCCC4)c3n2)cc1.
What is the InChIKey of 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane?
The InChIKey is MBEMPIKFXWHVIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F2N6.CH4/c23-14-9-11-15(12-10-14)26-21-25-13-19-20(29-21)30(16-5-1-2-6-16)22(28-19)27-18-8-4-3-7-17(18)24;/h3-4,7-13,16H,1-2,5-6H2,(H,27,28)(H,25,26,29);1H4.
What are the key properties of 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane?
9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane has a molecular weight of 422.48 g/mol, XLogP of 6.34, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(4-fluorophenyl)purine-2,8-diamine;methane is sourced from PubChem (CID 159515846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).