C50H43BrN6O2 — CID 159515946
6-bromobenzo[e]perimidin-7-one;4-tert-butylaniline;6-(4-tert-butylanilino)benzo[e]perimidin-7-one (PubChem CID 159515946) has the molecular formula C50H43BrN6O2 and a molecular weight of 839.84 g/mol. Its IUPAC name is 6-bromobenzo[e]perimidin-7-one;4-tert-butylaniline;6-(4-tert-butylanilino)benzo[e]perimidin-7-one.
| Compound Name | 6-bromobenzo[e]perimidin-7-one;4-tert-butylaniline;6-(4-tert-butylanilino)benzo[e]perimidin-7-one |
|---|---|
| PubChem CID | 159515946 |
| Molecular Formula | C50H43BrN6O2 |
| Molecular Weight | 839.84 g/mol |
| Exact Mass | 838.26 |
| IUPAC Name | 6-bromobenzo[e]perimidin-7-one;4-tert-butylaniline;6-(4-tert-butylanilino)benzo[e]perimidin-7-one |
| SMILES | CC(C)(C)c1ccc(N)cc1.CC(C)(C)c1ccc(Nc2ccc3ncnc4c3c2C(=O)c2ccccc2-4)cc1.O=C1c2ccccc2-c2ncnc3ccc(Br)c1c23 |
| InChI | InChI=1S/C25H21N3O.C15H7BrN2O.C10H15N/c1-25(2,3)15-8-10-16(11-9-15)28-20-13-12-19-21-22(20)24(29)18-7-5-4-6-17(18)23(21)27-14-26-19;16-10-5-6-11-13-12(10)15(19)9-4-2-1-3-8(9)14(13)18-7-17-11;1-10(2,3)8-4-6-9(11)7-5-8/h4-14,28H,1-3H3;1-7H;4-7H,11H2,1-3H3 |
| InChIKey | MBEUCLHRHRDWTE-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.84 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|