C28H29Cl2N3O4 — CID 159515998
5,7-dichloro-N-[2-(2,6-dimethylphenoxy)ethyl]-1-[2-oxo-3-(1-prop-2-enoylazetidin-3-yl)propyl]indole-3-carboxamide (PubChem CID 159515998) has the molecular formula C28H29Cl2N3O4 and a molecular weight of 542.46 g/mol. Its IUPAC name is 5,7-dichloro-N-[2-(2,6-dimethylphenoxy)ethyl]-1-[2-oxo-3-(1-prop-2-enoylazetidin-3-yl)propyl]indole-3-carboxamide.
| Compound Name | 5,7-dichloro-N-[2-(2,6-dimethylphenoxy)ethyl]-1-[2-oxo-3-(1-prop-2-enoylazetidin-3-yl)propyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 159515998 |
| Molecular Formula | C28H29Cl2N3O4 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 5,7-dichloro-N-[2-(2,6-dimethylphenoxy)ethyl]-1-[2-oxo-3-(1-prop-2-enoylazetidin-3-yl)propyl]indole-3-carboxamide |
| SMILES | C=CC(=O)N1CC(CC(=O)Cn2cc(C(=O)NCCOc3c(C)cccc3C)c3cc(Cl)cc(Cl)c32)C1 |
| InChI | InChI=1S/C28H29Cl2N3O4/c1-4-25(35)32-13-19(14-32)10-21(34)15-33-16-23(22-11-20(29)12-24(30)26(22)33)28(36)31-8-9-37-27-17(2)6-5-7-18(27)3/h4-7,11-12,16,19H,1,8-10,13-15H2,2-3H3,(H,31,36) |
| InChIKey | VTMFELLAKOKYEC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|