C16H14N4O2S — CID 15951676
4-methyl-1-oxo-N-(1,3-thiazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide (PubChem CID 15951676) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is 4-methyl-1-oxo-N-(1,3-thiazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide.
| Compound Name | 4-methyl-1-oxo-N-(1,3-thiazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 15951676 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 4-methyl-1-oxo-N-(1,3-thiazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
| SMILES | CC1CNC(=O)c2[nH]c3ccc(C(=O)Nc4nccs4)cc3c21 |
| InChI | InChI=1S/C16H14N4O2S/c1-8-7-18-15(22)13-12(8)10-6-9(2-3-11(10)19-13)14(21)20-16-17-4-5-23-16/h2-6,8,19H,7H2,1H3,(H,18,22)(H,17,20,21) |
| InChIKey | BWAAJKNSRSFMMW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|