C19H16BrN3O2 — CID 15951863
N-(3-bromophenyl)-4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide (PubChem CID 15951863) has the molecular formula C19H16BrN3O2 and a molecular weight of 398.26 g/mol. Its IUPAC name is N-(3-bromophenyl)-4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide.
| Compound Name | N-(3-bromophenyl)-4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 15951863 |
| Molecular Formula | C19H16BrN3O2 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | N-(3-bromophenyl)-4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
| SMILES | CC1CNC(=O)c2[nH]c3ccc(C(=O)Nc4cccc(Br)c4)cc3c21 |
| InChI | InChI=1S/C19H16BrN3O2/c1-10-9-21-19(25)17-16(10)14-7-11(5-6-15(14)23-17)18(24)22-13-4-2-3-12(20)8-13/h2-8,10,23H,9H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | ZPGNQCXYWXRURT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|