About (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane
(3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane (PubChem CID 159519461) has the molecular formula C7H16
and a molecular weight of 106.24 g/mol. Its IUPAC name is (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane.
Molecular Properties
| Compound Name | (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane |
| PubChem CID | 159519461 |
| Molecular Formula | C7H16 |
| Molecular Weight | 106.24 g/mol |
| Exact Mass | 106.16 |
| IUPAC Name | (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane |
| SMILES | [2H]C([2H])([2H])[C@]([2H])(C(C)C)C([2H])([2H])C |
| InChI | InChI=1S/C7H16/c1-5-7(4)6(2)3/h6-7H,5H2,1-4H3/t7-/m0/s1/i4D3,5D2,7D |
| InChIKey | WGECXQBGLLYSFP-XQSKGCSKSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane?
The IUPAC name of (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane (CID 159519461) is (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane.
What is the SMILES notation for (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane?
The canonical SMILES for (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane is [2H]C([2H])([2H])[C@]([2H])(C(C)C)C([2H])([2H])C.
What is the InChIKey of (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane?
The InChIKey is WGECXQBGLLYSFP-XQSKGCSKSA-N. The full InChI is InChI=1S/C7H16/c1-5-7(4)6(2)3/h6-7H,5H2,1-4H3/t7-/m0/s1/i4D3,5D2,7D.
What are the key properties of (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane?
(3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane has a molecular weight of 106.24 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,2,3-trideuterio-4-methyl-3-(trideuteriomethyl)pentane is sourced from PubChem (CID 159519461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).