C23H27N3O2S — CID 159520289
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[(5S)-1,1,5-trideuterio-5-hydroxy-5-(2,3,4,6-tetradeuterio-5-methylphenyl)pentyl]phenyl]acetamide (PubChem CID 159520289) has the molecular formula C23H27N3O2S and a molecular weight of 416.60 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[(5S)-1,1,5-trideuterio-5-hydroxy-5-(2,3,4,6-tetradeuterio-5-methylphenyl)pentyl]phenyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[(5S)-1,1,5-trideuterio-5-hydroxy-5-(2,3,4,6-tetradeuterio-5-methylphenyl)pentyl]phenyl]acetamide |
|---|---|
| PubChem CID | 159520289 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[(5S)-1,1,5-trideuterio-5-hydroxy-5-(2,3,4,6-tetradeuterio-5-methylphenyl)pentyl]phenyl]acetamide |
| SMILES | [2H]c1c([2H])c(C)c([2H])c([C@]([2H])(O)CCCC([2H])([2H])c2ccc(NC(=O)Cc3csc(N)n3)cc2)c1[2H] |
| InChI | InChI=1S/C23H27N3O2S/c1-16-5-4-7-18(13-16)21(27)8-3-2-6-17-9-11-19(12-10-17)25-22(28)14-20-15-29-23(24)26-20/h4-5,7,9-13,15,21,27H,2-3,6,8,14H2,1H3,(H2,24,26)(H,25,28)/t21-/m1/s1/i4D,5D,6D2,7D,13D,21D |
| InChIKey | FWRVKDXZILNTAF-NJZNUHLNSA-N |
| XLogP | 4.66 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |