C17H15N5O2 — CID 15952051
4-methyl-1-oxo-N-pyrazin-2-yl-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide (PubChem CID 15952051) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 4-methyl-1-oxo-N-pyrazin-2-yl-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide.
| Compound Name | 4-methyl-1-oxo-N-pyrazin-2-yl-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 15952051 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-methyl-1-oxo-N-pyrazin-2-yl-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
| SMILES | CC1CNC(=O)c2[nH]c3ccc(C(=O)Nc4cnccn4)cc3c21 |
| InChI | InChI=1S/C17H15N5O2/c1-9-7-20-17(24)15-14(9)11-6-10(2-3-12(11)21-15)16(23)22-13-8-18-4-5-19-13/h2-6,8-9,21H,7H2,1H3,(H,20,24)(H,19,22,23) |
| InChIKey | SCZSZUZHNGMDLI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|