C24H19ClN4O2 — CID 15952078
3-[2-chloro-7-[(dimethylamino)methyl]naphthalen-1-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione (PubChem CID 15952078) has the molecular formula C24H19ClN4O2 and a molecular weight of 430.90 g/mol. Its IUPAC name is 3-[2-chloro-7-[(dimethylamino)methyl]naphthalen-1-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione.
| Compound Name | 3-[2-chloro-7-[(dimethylamino)methyl]naphthalen-1-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 15952078 |
| Molecular Formula | C24H19ClN4O2 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 3-[2-chloro-7-[(dimethylamino)methyl]naphthalen-1-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione |
| SMILES | CN(C)Cc1ccc2ccc(Cl)c(C3=C(c4cnc5ccccn45)C(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C24H19ClN4O2/c1-28(2)13-14-6-7-15-8-9-17(25)20(16(15)11-14)22-21(23(30)27-24(22)31)18-12-26-19-5-3-4-10-29(18)19/h3-12H,13H2,1-2H3,(H,27,30,31) |
| InChIKey | MQJOFFBBMVEAGP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|