About azidobenzene;[(4-azidophenyl)disulfanyl] propanoate
azidobenzene;[(4-azidophenyl)disulfanyl] propanoate (PubChem CID 159520889) has the molecular formula C15H14N6O2S2
and a molecular weight of 374.45 g/mol. Its IUPAC name is azidobenzene;[(4-azidophenyl)disulfanyl] propanoate.
Molecular Properties
| Compound Name | azidobenzene;[(4-azidophenyl)disulfanyl] propanoate |
| PubChem CID | 159520889 |
| Molecular Formula | C15H14N6O2S2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | azidobenzene;[(4-azidophenyl)disulfanyl] propanoate |
| SMILES | CCC(=O)OSSc1ccc(N=[N+]=[N-])cc1.[N-]=[N+]=Nc1ccccc1 |
| InChI | InChI=1S/C9H9N3O2S2.C6H5N3/c1-2-9(13)14-16-15-8-5-3-7(4-6-8)11-12-10;7-9-8-6-4-2-1-3-5-6/h3-6H,2H2,1H3;1-5H |
| InChIKey | MBTYHGPGMQMXOM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 123.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azidobenzene;[(4-azidophenyl)disulfanyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidobenzene;[(4-azidophenyl)disulfanyl] propanoate?
The IUPAC name of azidobenzene;[(4-azidophenyl)disulfanyl] propanoate (CID 159520889) is azidobenzene;[(4-azidophenyl)disulfanyl] propanoate.
What is the SMILES notation for azidobenzene;[(4-azidophenyl)disulfanyl] propanoate?
The canonical SMILES for azidobenzene;[(4-azidophenyl)disulfanyl] propanoate is CCC(=O)OSSc1ccc(N=[N+]=[N-])cc1.[N-]=[N+]=Nc1ccccc1.
What is the InChIKey of azidobenzene;[(4-azidophenyl)disulfanyl] propanoate?
The InChIKey is MBTYHGPGMQMXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2S2.C6H5N3/c1-2-9(13)14-16-15-8-5-3-7(4-6-8)11-12-10;7-9-8-6-4-2-1-3-5-6/h3-6H,2H2,1H3;1-5H.
What are the key properties of azidobenzene;[(4-azidophenyl)disulfanyl] propanoate?
azidobenzene;[(4-azidophenyl)disulfanyl] propanoate has a molecular weight of 374.45 g/mol, XLogP of 6.87, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azidobenzene;[(4-azidophenyl)disulfanyl] propanoate is sourced from PubChem (CID 159520889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).